Products 2111422-69-4
CAS 2111422-69-4 is the registry number for Methyl 4,6-dichloro-1H-indazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4,6-dichloro-1H-indazole-3-carboxylate (CAS 2111422-69-4) is a chemical compound with the molecular formula C9H6Cl2N2O2 and a molecular weight of 245.06 g/mol. IUPAC name: methyl 4,6-dichloro-1H-indazole-3-carboxylate. InChIKey: QHZPUXWXZXLLGA-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O2 |
|---|---|
| Molecular weight | 245.06 g/mol |
| IUPAC name | methyl 4,6-dichloro-1H-indazole-3-carboxylate |
| InChIKey | QHZPUXWXZXLLGA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NNC2=C1C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)