CAS 27387-87-7 appears in our catalog under these names: Iprodione des-(N-isopropylcarboxamid), Iprodione Metabolite M1, Concentration: 100 µg/ml Solvent: Acetonitrile, Iprodione Metabolite M1. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 10mg, 1x1ml, 1x10mg.
3-(3,5-dichlorophenyl)imidazolidine-2,4-dione (CAS 27387-87-7) is a chemical compound with the molecular formula C9H6Cl2N2O2 and a molecular weight of 245.06 g/mol. IUPAC name: 3-(3,5-dichlorophenyl)imidazolidine-2,4-dione. InChIKey: OGCORJSEYZKHIN-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O2 |
|---|---|
| Molecular weight | 245.06 g/mol |
| IUPAC name | 3-(3,5-dichlorophenyl)imidazolidine-2,4-dione |
| InChIKey | OGCORJSEYZKHIN-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)N1)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)