CAS 59128-14-2 is the registry number for 2-(6,8-Dichloroimidazo[1,2-a]pyridin-2-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)acetic acid (CAS 59128-14-2) is a chemical compound with the molecular formula C9H6Cl2N2O2 and a molecular weight of 245.06 g/mol. IUPAC name: 2-(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)acetic acid. InChIKey: BVIKWSHXSKAPIL-UHFFFAOYSA-N.
| Molecular formula | C9H6Cl2N2O2 |
|---|---|
| Molecular weight | 245.06 g/mol |
| IUPAC name | 2-(6,8-dichloroimidazo[1,2-a]pyridin-2-yl)acetic acid |
| InChIKey | BVIKWSHXSKAPIL-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC(=CN2C=C1Cl)CC(=O)O)Cl |
Computed by PubChem (NCBI)