CAS 129768-28-1 appears in our catalog under these names: 5-(Trifluoromethyl)-1H-pyrazole-3-carboxylic acid 98%, 5-(Trifluoromethyl)-1H-pyrazole-3-carboxylic acid, 97%, 97%, 3-Trifluoromethyl-1H-pyrazole-5-carboxylic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid (CAS 129768-28-1) is a chemical compound with the molecular formula C5H3F3N2O2 and a molecular weight of 180.08 g/mol. IUPAC name: 5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid. InChIKey: CIVNBJPTGRMGRS-UHFFFAOYSA-N.
| Molecular formula | C5H3F3N2O2 |
|---|---|
| Molecular weight | 180.08 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1H-pyrazole-3-carboxylic acid |
| InChIKey | CIVNBJPTGRMGRS-UHFFFAOYSA-N |
| SMILES | C1=C(NN=C1C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)