CAS 2386464-95-3 is the registry number for 4-(Trifluoromethyl)pyridazine-3,5-diol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-hydroxy-5-(trifluoromethyl)-1H-pyridazin-6-one (CAS 2386464-95-3) is a chemical compound with the molecular formula C5H3F3N2O2 and a molecular weight of 180.08 g/mol. IUPAC name: 4-hydroxy-5-(trifluoromethyl)-1H-pyridazin-6-one. InChIKey: FPVGBHCCUBGBQU-UHFFFAOYSA-N.
| Molecular formula | C5H3F3N2O2 |
|---|---|
| Molecular weight | 180.08 g/mol |
| IUPAC name | 4-hydroxy-5-(trifluoromethyl)-1H-pyridazin-6-one |
| InChIKey | FPVGBHCCUBGBQU-UHFFFAOYSA-N |
| SMILES | C1=NNC(=O)C(=C1O)C(F)(F)F |
Computed by PubChem (NCBI)