Products 78016-98-5
CAS 78016-98-5 appears in our catalog under these names: 2–(Trifluoromethyl)–1H–imidazole–5–carboxylic acid, 2-(Trifluoromethyl)-1H-imidazole-5-carboxylic acid, 96%, 2-(Trifluoromethyl)-1H-imidazole-5-carboxylic acid 96%, 1H-Imidazole-5-carboxylic acid, 2-(trifluoromethyl)-, 96%, 96%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 50mg, 5g, 1g, 100mg.
2-(trifluoromethyl)-1H-imidazole-5-carboxylic acid (CAS 78016-98-5) is a chemical compound with the molecular formula C5H3F3N2O2 and a molecular weight of 180.08 g/mol. IUPAC name: 2-(trifluoromethyl)-1H-imidazole-5-carboxylic acid. InChIKey: DQPSZGHYQKCZEY-UHFFFAOYSA-N.
| Molecular formula | C5H3F3N2O2 |
|---|---|
| Molecular weight | 180.08 g/mol |
| IUPAC name | 2-(trifluoromethyl)-1H-imidazole-5-carboxylic acid |
| InChIKey | DQPSZGHYQKCZEY-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=N1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)