CAS 54-20-6 appears in our catalog under these names: Trifluorothymine, Trifluorothymine, >95% (HPLC), 5-Trifluorothymine, 5-(Trifluoromethyl)uracil, >97.0%(HPLC), Trifluorothymine 97%. Offered by: Chemat Brand, TRC, Biosynth, TCI, Ambeed. Available pack sizes: on request, 5g, 10g, 1g, 25g, 50g, 100g, 500g.
5-(trifluoromethyl)-1H-pyrimidine-2,4-dione (CAS 54-20-6) is a chemical compound with the molecular formula C5H3F3N2O2 and a molecular weight of 180.08 g/mol. IUPAC name: 5-(trifluoromethyl)-1H-pyrimidine-2,4-dione. InChIKey: LMNPKIOZMGYQIU-UHFFFAOYSA-N.
| Molecular formula | C5H3F3N2O2 |
|---|---|
| Molecular weight | 180.08 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| InChIKey | LMNPKIOZMGYQIU-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1)C(F)(F)F |
Computed by PubChem (NCBI)