Products 1402664-77-0
CAS 1402664-77-0 appears in our catalog under these names: 1-(Trifluoromethyl)-1h-pyrazole-4-carboxylic acid, 95%, 1-(Trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 1-(Trifluoromethyl)-1H-pyrazole-4-carboxylic acid 98%, 1-(Trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 98%, 98%, 1-(Trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 250mg, 50mg, 0,5g, 500mg.
1-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 1402664-77-0) is a chemical compound with the molecular formula C5H3F3N2O2 and a molecular weight of 180.08 g/mol. IUPAC name: 1-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: MCLKZJLGDFGFLI-UHFFFAOYSA-N.
| Molecular formula | C5H3F3N2O2 |
|---|---|
| Molecular weight | 180.08 g/mol |
| IUPAC name | 1-(trifluoromethyl)pyrazole-4-carboxylic acid |
| InChIKey | MCLKZJLGDFGFLI-UHFFFAOYSA-N |
| SMILES | C1=C(C=NN1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)