CAS 543739-84-0 appears in our catalog under these names: 5-(Trifluoromethyl)-1H-pyrazole-4-carboxylic Acid, >95% (HPLC), 3–(Trifluoromethyl)pyrazole–4–carboxylic acid, 5-(Trifluoromethyl)-1H-pyrazole-4-carboxylic acid 97%, Penthiopyrad Metabolite DM-PCA, 3-(Trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: TRC, GLPBio, Ambeed, HPC Standards, Fluorochem. Available pack sizes: 100mg, 500mg, 50mg, 1g, 5g, 250mg, 25g, 1x100mg.
5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS 543739-84-0) is a chemical compound with the molecular formula C5H3F3N2O2 and a molecular weight of 180.08 g/mol. IUPAC name: 5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid. InChIKey: VHKMTORCXXPIFI-UHFFFAOYSA-N.
| Molecular formula | C5H3F3N2O2 |
|---|---|
| Molecular weight | 180.08 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid |
| InChIKey | VHKMTORCXXPIFI-UHFFFAOYSA-N |
| SMILES | C1=NNC(=C1C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)