CAS 672-47-9 appears in our catalog under these names: 2-(Trifluoromethyl)pyrimidine-4,6-diol, 95%, 2–(Trifluoromethyl)pyrimidine–4,6–diol, 2-(Trifluoromethyl)pyrimidine-4,6-diol 97%, 2-(Trifluoromethyl)pyrimidine-4,6-diol. Offered by: Combi-blocks, GLPBio, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g.
4-hydroxy-2-(trifluoromethyl)-1H-pyrimidin-6-one (CAS 672-47-9) is a chemical compound with the molecular formula C5H3F3N2O2 and a molecular weight of 180.08 g/mol. IUPAC name: 4-hydroxy-2-(trifluoromethyl)-1H-pyrimidin-6-one. InChIKey: AMGBKPNVGVAFEN-UHFFFAOYSA-N.
| Molecular formula | C5H3F3N2O2 |
|---|---|
| Molecular weight | 180.08 g/mol |
| IUPAC name | 4-hydroxy-2-(trifluoromethyl)-1H-pyrimidin-6-one |
| InChIKey | AMGBKPNVGVAFEN-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(NC1=O)C(F)(F)F)O |
Computed by PubChem (NCBI)