CAS 130008-09-2 appears in our catalog under these names: (R)-Methyl 2-(methylamino)-3-phenylpropanoate hydrochloride, 97%, N-Methyl-methyl ester D-Phenylalanine Hydrochloride, N-Methyl-D-phenylalanine methyl ester hydrochloride. Offered by: AmBeed, TRC, Biosynth. Available pack sizes: 1g, 5g, 500mg, 50mg, 0,5g.
Methyl (2R)-2-(methylamino)-3-phenylpropanoate;hydrochloride (CAS 130008-09-2) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: methyl (2R)-2-(methylamino)-3-phenylpropanoate;hydrochloride. InChIKey: ZIFGLAQTUGRAAB-HNCPQSOCSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | methyl (2R)-2-(methylamino)-3-phenylpropanoate;hydrochloride |
| InChIKey | ZIFGLAQTUGRAAB-HNCPQSOCSA-N |
| SMILES | CN[C@H](CC1=CC=CC=C1)C(=O)OC.Cl |
Computed by PubChem (NCBI)