CAS 13041-62-8 appears in our catalog under these names: 4-Methoxy-1-naphthoic acid, 98%, 4-Methoxy-1-naphthoic Acid, 4–Methoxy–1–naphthoic Acid, 4-Methoxynaphthalene-1-carboxylic acid, 98% , 4-Methoxy-1-naphthoic Acid, >98.0%(GC)(T). Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 25g, 100g, 5g, 100mg, 25mg, 10g, 250mg.
4-methoxynaphthalene-1-carboxylic acid (CAS 13041-62-8) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 4-methoxynaphthalene-1-carboxylic acid. InChIKey: WRQHSQDGYYDRMX-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 4-methoxynaphthalene-1-carboxylic acid |
| InChIKey | WRQHSQDGYYDRMX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)