Products 130420-85-8
CAS 130420-85-8 appears in our catalog under these names: 5-Bromo-6-methoxyindoline-2,3-dione, 98%, 5-Bromo-6-methoxy-1H-indole-2,3-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg.
5-bromo-6-methoxy-1H-indole-2,3-dione (CAS 130420-85-8) is a chemical compound with the molecular formula C9H6BrNO3 and a molecular weight of 256.05 g/mol. IUPAC name: 5-bromo-6-methoxy-1H-indole-2,3-dione. InChIKey: NYNDSMPCFVOHHO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO3 |
|---|---|
| Molecular weight | 256.05 g/mol |
| IUPAC name | 5-bromo-6-methoxy-1H-indole-2,3-dione |
| InChIKey | NYNDSMPCFVOHHO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)NC(=O)C2=O)Br |
Computed by PubChem (NCBI)