CAS 13051-16-6 is the registry number for Levosimendan Impurity 43. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-methyl-3-(4-nitrophenyl)-3-oxopropanoate (CAS 13051-16-6) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: ethyl 2-methyl-3-(4-nitrophenyl)-3-oxopropanoate. InChIKey: NIHZSJQULLYAOS-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | ethyl 2-methyl-3-(4-nitrophenyl)-3-oxopropanoate |
| InChIKey | NIHZSJQULLYAOS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)C(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)