CAS 13052-92-1 appears in our catalog under these names: ETHYL 3–AMINO–4–HYDROXYBENZOATE, Ethyl 3-Amino-4-hydroxybenzoate 95%, Benzoic acid, 3-amino-4-hydroxy-, ethyl ester, 95%, 95%, ethyl 3-amino-4-hydroxybenzoate, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
Ethyl 3-amino-4-hydroxybenzoate (CAS 13052-92-1) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: ethyl 3-amino-4-hydroxybenzoate. InChIKey: WQSOFWIIBNJWSS-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | ethyl 3-amino-4-hydroxybenzoate |
| InChIKey | WQSOFWIIBNJWSS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)O)N |
Computed by PubChem (NCBI)