CAS 130598-89-9 is the registry number for 6-(Thiophen-2-yl)-1H-imidazo(1,2-b)pyrazole. Offered by: TRC. Available pack sizes: 250mg.
6-thiophen-2-yl-5H-imidazo[1,2-b]pyrazole (CAS 130598-89-9) is a chemical compound with the molecular formula C9H7N3S and a molecular weight of 189.24 g/mol. IUPAC name: 6-thiophen-2-yl-5H-imidazo[1,2-b]pyrazole. InChIKey: NFOVYUBALZPVOZ-UHFFFAOYSA-N.
| Molecular formula | C9H7N3S |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 6-thiophen-2-yl-5H-imidazo[1,2-b]pyrazole |
| InChIKey | NFOVYUBALZPVOZ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC3=NC=CN3N2 |
Computed by PubChem (NCBI)