CAS 90323-39-0 is the registry number for 1-Methyl-2-sulfanyl-1H-1,3-benzodiazole-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-methyl-2-sulfanylidene-3H-benzimidazole-5-carbonitrile (CAS 90323-39-0) is a chemical compound with the molecular formula C9H7N3S and a molecular weight of 189.24 g/mol. IUPAC name: 1-methyl-2-sulfanylidene-3H-benzimidazole-5-carbonitrile. InChIKey: HYGOBXGPMCBUHO-UHFFFAOYSA-N.
| Molecular formula | C9H7N3S |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 1-methyl-2-sulfanylidene-3H-benzimidazole-5-carbonitrile |
| InChIKey | HYGOBXGPMCBUHO-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C#N)NC1=S |
Computed by PubChem (NCBI)