CAS 92987-73-0 is the registry number for N-(6-Methylbenzo[d]thiazol-2-yl)cyanamide, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(6-methyl-1,3-benzothiazol-2-yl)cyanamide (CAS 92987-73-0) is a chemical compound with the molecular formula C9H7N3S and a molecular weight of 189.24 g/mol. IUPAC name: (6-methyl-1,3-benzothiazol-2-yl)cyanamide. InChIKey: TXWAFQDIPWCYOK-UHFFFAOYSA-N.
| Molecular formula | C9H7N3S |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | (6-methyl-1,3-benzothiazol-2-yl)cyanamide |
| InChIKey | TXWAFQDIPWCYOK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(S2)NC#N |
Computed by PubChem (NCBI)