CAS 874779-72-3 appears in our catalog under these names: 4-Pyridin-4-ylpyrimidine-2(1h)-thione, 95%, 4-(Pyridin-4-yl)pyrimidine-2-thiol. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 0,5g, 5g.
6-pyridin-4-yl-1H-pyrimidine-2-thione (CAS 874779-72-3) is a chemical compound with the molecular formula C9H7N3S and a molecular weight of 189.24 g/mol. IUPAC name: 6-pyridin-4-yl-1H-pyrimidine-2-thione. InChIKey: BXIKZEVIUVMSNP-UHFFFAOYSA-N.
| Molecular formula | C9H7N3S |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 6-pyridin-4-yl-1H-pyrimidine-2-thione |
| InChIKey | BXIKZEVIUVMSNP-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CC=NC(=S)N2 |
Computed by PubChem (NCBI)