CAS 34091-38-8 appears in our catalog under these names: 2-(Thiocyanatomethyl)-1H-benzo(d)imidazole, 97%, {((1H-1,3-Benzodiazol-2-yl)methyl)sulfanyl}carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1H-benzimidazol-2-ylmethyl thiocyanate (CAS 34091-38-8) is a chemical compound with the molecular formula C9H7N3S and a molecular weight of 189.24 g/mol. IUPAC name: 1H-benzimidazol-2-ylmethyl thiocyanate. InChIKey: NPYHFFYLECPPGJ-UHFFFAOYSA-N.
| Molecular formula | C9H7N3S |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 1H-benzimidazol-2-ylmethyl thiocyanate |
| InChIKey | NPYHFFYLECPPGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=N2)CSC#N |
Computed by PubChem (NCBI)