Products 267417-49-2
CAS 267417-49-2 is the registry number for (E)-2-(Phenyldiazenyl)thiazole 95%. Offered by: Ambeed. Available pack sizes: 25mg, 50mg, 100mg.
Phenyl(1,3-thiazol-2-yl)diazene (CAS 267417-49-2) is a chemical compound with the molecular formula C9H7N3S and a molecular weight of 189.24 g/mol. IUPAC name: phenyl(1,3-thiazol-2-yl)diazene. InChIKey: LQHUZEZZFLVJAZ-UHFFFAOYSA-N.
| Molecular formula | C9H7N3S |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | phenyl(1,3-thiazol-2-yl)diazene |
| InChIKey | LQHUZEZZFLVJAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=NC=CS2 |
Computed by PubChem (NCBI)