Products 1356928-69-2

CAS 1356928-69-2 is the registry number for Tricyclazole-3-13C-1,2-15N2. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

8-methyl-(513C,1,2-15N2)[1,2,4]triazolo[3,4-b][1,3]benzothiazole (CAS 1356928-69-2) is a chemical compound with the molecular formula C9H7N3S and a molecular weight of 192.22 g/mol. IUPAC name: 8-methyl-(513C,1,2-15N2)[1,2,4]triazolo[3,4-b][1,3]benzothiazole. InChIKey: DQJCHOQLCLEDLL-UAPAWMPQSA-N.

Identity
Molecular formulaC9H7N3S
Molecular weight192.22 g/mol
IUPAC name8-methyl-(513C,1,2-15N2)[1,2,4]triazolo[3,4-b][1,3]benzothiazole
InChIKeyDQJCHOQLCLEDLL-UAPAWMPQSA-N
SMILESCC1=C2C(=CC=C1)SC3=[15N][15N]=[13CH]N23

Computed by PubChem (NCBI)