Products 1309125-17-4
CAS 1309125-17-4 appears in our catalog under these names: Sampsone B, Sampsone B. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
(4aR,10aR)-3,4a,7,10a-tetramethoxy-4H-dibenzo-p-dioxin-1-one (CAS 1309125-17-4) is a chemical compound with the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. IUPAC name: (4aR,10aR)-3,4a,7,10a-tetramethoxy-4H-dibenzo-p-dioxin-1-one. InChIKey: VVGCXZDHBJNPRE-HZPDHXFCSA-N.
| Molecular formula | C16H18O7 |
|---|---|
| Molecular weight | 322.31 g/mol |
| IUPAC name | (4aR,10aR)-3,4a,7,10a-tetramethoxy-4H-dibenzo-p-dioxin-1-one |
| InChIKey | VVGCXZDHBJNPRE-HZPDHXFCSA-N |
| SMILES | COC1=CC(=O)[C@@]2([C@@](C1)(OC3=C(O2)C=CC(=C3)OC)OC)OC |
Computed by PubChem (NCBI)
Synonyms:
Sampsone B, orb1681000