Products 88144-75-6

CAS 88144-75-6 is the registry number for 1,2-Benzenedicarboxylic Acid Mono(5-carboxy-2-ethyl-4-oxopentyl) Ester. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

2-(5-carboxy-2-ethyl-4-oxopentoxy)carbonylbenzoic acid (CAS 88144-75-6) is a chemical compound with the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. IUPAC name: 2-(5-carboxy-2-ethyl-4-oxopentoxy)carbonylbenzoic acid. InChIKey: SWWCOKPGMIEQMA-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18O7
Molecular weight322.31 g/mol
IUPAC name2-(5-carboxy-2-ethyl-4-oxopentoxy)carbonylbenzoic acid
InChIKeySWWCOKPGMIEQMA-UHFFFAOYSA-N
SMILESCCC(CC(=O)CC(=O)O)COC(=O)C1=CC=CC=C1C(=O)O

Computed by PubChem (NCBI)