Products 4613-71-2

CAS 4613-71-2 is the registry number for 1,2-O-Di-O-acetyl-5-O-benzoyl-3-deoxy-D-ribofuranose. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 2000mg, 1000mg.

Structural formula: {0} (CAS {1})

[(2S,4R)-4,5-diacetyloxyoxolan-2-yl]methyl benzoate (CAS 4613-71-2) is a chemical compound with the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. IUPAC name: [(2S,4R)-4,5-diacetyloxyoxolan-2-yl]methyl benzoate. InChIKey: DPLPHOLDKAGPOZ-NNKZFNQJSA-N.

Identity
Molecular formulaC16H18O7
Molecular weight322.31 g/mol
IUPAC name[(2S,4R)-4,5-diacetyloxyoxolan-2-yl]methyl benzoate
InChIKeyDPLPHOLDKAGPOZ-NNKZFNQJSA-N
SMILESCC(=O)O[C@@H]1C[C@H](OC1OC(=O)C)COC(=O)C2=CC=CC=C2

Computed by PubChem (NCBI)