CAS 4613-71-2 is the registry number for 1,2-O-Di-O-acetyl-5-O-benzoyl-3-deoxy-D-ribofuranose. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 2000mg, 1000mg.
[(2S,4R)-4,5-diacetyloxyoxolan-2-yl]methyl benzoate (CAS 4613-71-2) is a chemical compound with the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. IUPAC name: [(2S,4R)-4,5-diacetyloxyoxolan-2-yl]methyl benzoate. InChIKey: DPLPHOLDKAGPOZ-NNKZFNQJSA-N.
| Molecular formula | C16H18O7 |
|---|---|
| Molecular weight | 322.31 g/mol |
| IUPAC name | [(2S,4R)-4,5-diacetyloxyoxolan-2-yl]methyl benzoate |
| InChIKey | DPLPHOLDKAGPOZ-NNKZFNQJSA-N |
| SMILES | CC(=O)O[C@@H]1C[C@H](OC1OC(=O)C)COC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)