Products 2714431-33-9
CAS 2714431-33-9 is the registry number for Mono(5-carboxy-2-ethyl-4-oxopentyl) Phthalate-d4. Offered by: TRC. Available pack sizes: 75mg.
2-(5-carboxy-2-ethyl-4-oxopentoxy)carbonyl-3,4,5,6-tetradeuteriobenzoic acid (CAS 2714431-33-9) is a chemical compound with the molecular formula C16H18O7 and a molecular weight of 326.33 g/mol. IUPAC name: 2-(5-carboxy-2-ethyl-4-oxopentoxy)carbonyl-3,4,5,6-tetradeuteriobenzoic acid. InChIKey: SWWCOKPGMIEQMA-LNFUJOGGSA-N.
| Molecular formula | C16H18O7 |
|---|---|
| Molecular weight | 326.33 g/mol |
| IUPAC name | 2-(5-carboxy-2-ethyl-4-oxopentoxy)carbonyl-3,4,5,6-tetradeuteriobenzoic acid |
| InChIKey | SWWCOKPGMIEQMA-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCC(CC)CC(=O)CC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)