CAS 5509-70-6 appears in our catalog under these names: 4–O–Cinnamoylquinic acid, 4-O-Cinnamoylquinic acid/ 98.04% (existing batch purity), 4-O-Cinnamoylquinic acid, ≥98%, ≥98%, 4-O-Cinnamoylquinic acid. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 10 mg, 5 mg.
1,3,5-trihydroxy-4-[(E)-3-phenylprop-2-enoyl]oxycyclohexane-1-carboxylic acid (CAS 5509-70-6) is a chemical compound with the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. IUPAC name: 1,3,5-trihydroxy-4-[(E)-3-phenylprop-2-enoyl]oxycyclohexane-1-carboxylic acid. InChIKey: CLDAKARZYFIUGC-VOTSOKGWSA-N.
| Molecular formula | C16H18O7 |
|---|---|
| Molecular weight | 322.31 g/mol |
| IUPAC name | 1,3,5-trihydroxy-4-[(E)-3-phenylprop-2-enoyl]oxycyclohexane-1-carboxylic acid |
| InChIKey | CLDAKARZYFIUGC-VOTSOKGWSA-N |
| SMILES | C1C(C(C(CC1(C(=O)O)O)O)OC(=O)/C=C/C2=CC=CC=C2)O |
Computed by PubChem (NCBI)