CAS 55487-93-9 appears in our catalog under these names: 4-Methylumbelliferyl Beta-D-Fucoside, >95% (HPLC), 4-Methylumbelliferyl-beta-D-fucopyranoside, 4-Methylumbelliferyl β-D-fucoside. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 25mg, 50mg, 0,5g, 0,25g, 1g, 2,5g, 5g, 250 mg.
4-methyl-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-2-one (CAS 55487-93-9) is a chemical compound with the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. IUPAC name: 4-methyl-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-2-one. InChIKey: CQKHENXHLAUMBH-OSLYUKSHSA-N.
| Molecular formula | C16H18O7 |
|---|---|
| Molecular weight | 322.31 g/mol |
| IUPAC name | 4-methyl-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-2-one |
| InChIKey | CQKHENXHLAUMBH-OSLYUKSHSA-N |
| SMILES | C[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC2=CC3=C(C=C2)C(=CC(=O)O3)C)O)O)O |
Computed by PubChem (NCBI)