CAS 6470-68-4 appears in our catalog under these names: 5–O–Cinnamoylquinic acid, 5-O-Cinnamoylquinic acid/ 99.66% (existing batch purity), (E)–5–O–Cinnamoylquinic acid, (E)-5-O-Cinnamoylquinic acid, (E)-5-O-Cinnamoylquinic acid, 99.49%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 2mg, 10mg, 5 mg.
(1S,3S,4R,5S)-1,3,4-trihydroxy-5-[(E)-3-phenylprop-2-enoyl]oxycyclohexane-1-carboxylic acid (CAS 6470-68-4) is a chemical compound with the molecular formula C16H18O7 and a molecular weight of 322.31 g/mol. IUPAC name: (1S,3S,4R,5S)-1,3,4-trihydroxy-5-[(E)-3-phenylprop-2-enoyl]oxycyclohexane-1-carboxylic acid. InChIKey: WTMHIVNZOSRKJU-MUMPLMHTSA-N.
| Molecular formula | C16H18O7 |
|---|---|
| Molecular weight | 322.31 g/mol |
| IUPAC name | (1S,3S,4R,5S)-1,3,4-trihydroxy-5-[(E)-3-phenylprop-2-enoyl]oxycyclohexane-1-carboxylic acid |
| InChIKey | WTMHIVNZOSRKJU-MUMPLMHTSA-N |
| SMILES | C1[C@@H]([C@H]([C@H](C[C@@]1(C(=O)O)O)OC(=O)/C=C/C2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)