CAS 1807920-18-8 is the registry number for rac-(1R,2S)-2-(3,5-Difluorophenoxy)cyclopentan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Cis-(1R,2S)-2-(3,5-difluorophenoxy)cyclopentan-1-amine;hydrochloride (CAS 1807920-18-8) is a chemical compound with the molecular formula C11H14ClF2NO and a molecular weight of 249.68 g/mol. IUPAC name: cis-(1R,2S)-2-(3,5-difluorophenoxy)cyclopentan-1-amine;hydrochloride. InChIKey: BDFRYGKBOALYAW-DHXVBOOMSA-N.
| Molecular formula | C11H14ClF2NO |
|---|---|
| Molecular weight | 249.68 g/mol |
| IUPAC name | cis-(1R,2S)-2-(3,5-difluorophenoxy)cyclopentan-1-amine;hydrochloride |
| InChIKey | BDFRYGKBOALYAW-DHXVBOOMSA-N |
| SMILES | C1C[C@H]([C@H](C1)OC2=CC(=CC(=C2)F)F)N.Cl |
Computed by PubChem (NCBI)