Products 13120-33-7
CAS 13120-33-7 appears in our catalog under these names: 2-(Methyl(phenyl)amino)-2-oxoacetic acid, 95%, [methyl(phenyl)amino](oxo)acetic acid, 98%, 2-(Methyl(phenyl)amino)-2-oxoacetic acid, 98%. Offered by: Ambeed, Fluorochem, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-(N-methylanilino)-2-oxoacetic acid (CAS 13120-33-7) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 2-(N-methylanilino)-2-oxoacetic acid. InChIKey: RMOUHWPZZGSLOT-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 2-(N-methylanilino)-2-oxoacetic acid |
| InChIKey | RMOUHWPZZGSLOT-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1)C(=O)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
[methyl(phenyl)amino](oxo)acetic acid, 2-(Methyl(phenyl)amino)-2-oxoacetic acid, [methyl(phenyl)carbamoyl]formic acid, 2-(N-methylanilino)-2-oxoacetic acid, Acetic acid, (methylphenylamino)oxo-, 2-[Methyl(phenyl)amino]-2-oxoacetic Acid, Oxamic Acid/Ester, 24, 2-(N-methylanilino)-2-oxo-acetic acid, 2-keto-2-(methyl-phenyl-amino)acetic acid, Acetic acid, 2-(methylphenylamino)-2-oxo-