Products 1313183-12-8

CAS 1313183-12-8 is the registry number for H-DL-Lys(Fmoc)-OH 98%. Offered by: Ambeed. Available pack sizes: 500g, 5g, 25g, 100g.

Structural formula: {0} (CAS {1})

2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 1313183-12-8) is a chemical compound with the molecular formula C21H24N2O4 and a molecular weight of 368.4 g/mol. IUPAC name: 2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: RAQBUPMYCNRBCQ-UHFFFAOYSA-N.

Identity
Molecular formulaC21H24N2O4
Molecular weight368.4 g/mol
IUPAC name2-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid
InChIKeyRAQBUPMYCNRBCQ-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCC(C(=O)O)N

Computed by PubChem (NCBI)