Products 13135-86-9

CAS 13135-86-9 is the registry number for Balsalazide Impurity 30. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[(2-nitrobenzoyl)amino]propanoic acid (CAS 13135-86-9) is a chemical compound with the molecular formula C10H10N2O5 and a molecular weight of 238.20 g/mol. IUPAC name: 3-[(2-nitrobenzoyl)amino]propanoic acid. InChIKey: QWMGKRJPWNOKDR-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N2O5
Molecular weight238.20 g/mol
IUPAC name3-[(2-nitrobenzoyl)amino]propanoic acid
InChIKeyQWMGKRJPWNOKDR-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NCCC(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)