CAS 13137-69-4 is the registry number for 1,5-Anhydro-D-glucitol 2,3,4,6-Tetraacetate. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
[(2R,3R,4R,5S)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate (CAS 13137-69-4) is a chemical compound with the molecular formula C14H20O9 and a molecular weight of 332.30 g/mol. IUPAC name: [(2R,3R,4R,5S)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate. InChIKey: ULWHEXUWXLOVPV-XJFOESAGSA-N.
| Molecular formula | C14H20O9 |
|---|---|
| Molecular weight | 332.30 g/mol |
| IUPAC name | [(2R,3R,4R,5S)-3,4,5-triacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | ULWHEXUWXLOVPV-XJFOESAGSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H](CO1)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)