CAS 17081-04-8 is the registry number for (2S,3R,4S,5R,6R)-6-Methyltetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate (CAS 17081-04-8) is a chemical compound with the molecular formula C14H20O9 and a molecular weight of 332.30 g/mol. IUPAC name: [(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate. InChIKey: QZQMGQQOGJIDKJ-NTXHMQPZSA-N.
| Molecular formula | C14H20O9 |
|---|---|
| Molecular weight | 332.30 g/mol |
| IUPAC name | [(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate |
| InChIKey | QZQMGQQOGJIDKJ-NTXHMQPZSA-N |
| SMILES | C[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)