CAS 7404-35-5 is the registry number for α-D-Glucopyranose, 6-deoxy-, 1,2,3,4-tetraacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate (CAS 7404-35-5) is a chemical compound with the molecular formula C14H20O9 and a molecular weight of 332.30 g/mol. IUPAC name: (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate. InChIKey: QZQMGQQOGJIDKJ-UHFFFAOYSA-N.
| Molecular formula | C14H20O9 |
|---|---|
| Molecular weight | 332.30 g/mol |
| IUPAC name | (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate |
| InChIKey | QZQMGQQOGJIDKJ-UHFFFAOYSA-N |
| SMILES | CC1C(C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)