Products 7404-35-5

CAS 7404-35-5 is the registry number for α-D-Glucopyranose, 6-deoxy-, 1,2,3,4-tetraacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate (CAS 7404-35-5) is a chemical compound with the molecular formula C14H20O9 and a molecular weight of 332.30 g/mol. IUPAC name: (4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate. InChIKey: QZQMGQQOGJIDKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H20O9
Molecular weight332.30 g/mol
IUPAC name(4,5,6-triacetyloxy-2-methyloxan-3-yl) acetate
InChIKeyQZQMGQQOGJIDKJ-UHFFFAOYSA-N
SMILESCC1C(C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C

Computed by PubChem (NCBI)