CAS 65729-88-6 appears in our catalog under these names: 2,5-Anhydro-D-mannitol Tetraacetate, D-Mannitol,2,5-anhydro,1,3,4,6-tetraacetate. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 250mg, 100mg, 500mg, 1000mg, Get quote.
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]methyl acetate (CAS 65729-88-6) is a chemical compound with the molecular formula C14H20O9 and a molecular weight of 332.30 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]methyl acetate. InChIKey: LRVQZSOYVOEEPQ-AAVRWANBSA-N.
| Molecular formula | C14H20O9 |
|---|---|
| Molecular weight | 332.30 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]methyl acetate |
| InChIKey | LRVQZSOYVOEEPQ-AAVRWANBSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H](O1)COC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)