Products 50615-78-6
CAS 50615-78-6 appears in our catalog under these names: (2R,3S,4R,5R,6S)-6-Methyltetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate, 98%, 1,2,3,4-Tetra-O-acetyl-b-L-fucopyranose. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 50g.
[(2S,3R,4R,5S,6R)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate (CAS 50615-78-6) is a chemical compound with the molecular formula C14H20O9 and a molecular weight of 332.30 g/mol. IUPAC name: [(2S,3R,4R,5S,6R)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate. InChIKey: QZQMGQQOGJIDKJ-BUPNJJSDSA-N.
| Molecular formula | C14H20O9 |
|---|---|
| Molecular weight | 332.30 g/mol |
| IUPAC name | [(2S,3R,4R,5S,6R)-4,5,6-triacetyloxy-2-methyloxan-3-yl] acetate |
| InChIKey | QZQMGQQOGJIDKJ-BUPNJJSDSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@H](O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)