Products 1314140-36-7
CAS 1314140-36-7 appears in our catalog under these names: 1-Methyl-2-oxopyridine-3-boronic acid, pinacol ester, 96%, 1-Methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2(1H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one (CAS 1314140-36-7) is a chemical compound with the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. IUPAC name: 1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one. InChIKey: PNRZXUANEKDDHK-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO3 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | 1-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-one |
| InChIKey | PNRZXUANEKDDHK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CN(C2=O)C |
Computed by PubChem (NCBI)