CAS 1315361-24-0 is the registry number for Methyl 5-methoxy-6-methylpicolinate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 5-methoxy-6-methylpyridine-2-carboxylate (CAS 1315361-24-0) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: methyl 5-methoxy-6-methylpyridine-2-carboxylate. InChIKey: KNHDIULGDLMXFQ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | methyl 5-methoxy-6-methylpyridine-2-carboxylate |
| InChIKey | KNHDIULGDLMXFQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)C(=O)OC)OC |
Computed by PubChem (NCBI)