CAS 1316224-76-6 is the registry number for 8-formyl ophiopogonanone B, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 5mg.
(3R)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6-methyl-4-oxo-2,3-dihydrochromene-8-carbaldehyde (CAS 1316224-76-6) is a chemical compound with the molecular formula C19H18O6 and a molecular weight of 342.3 g/mol. IUPAC name: (3R)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6-methyl-4-oxo-2,3-dihydrochromene-8-carbaldehyde. InChIKey: RDMYSZGUHAXMQC-GFCCVEGCSA-N.
| Molecular formula | C19H18O6 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | (3R)-5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6-methyl-4-oxo-2,3-dihydrochromene-8-carbaldehyde |
| InChIKey | RDMYSZGUHAXMQC-GFCCVEGCSA-N |
| SMILES | CC1=C(C(=C2C(=C1O)C(=O)[C@@H](CO2)CC3=CC=C(C=C3)OC)C=O)O |
Computed by PubChem (NCBI)