CAS 131947-81-4 appears in our catalog under these names: 2,4-Dimethoxy-benzamidine hydrochloride, 95%, 2,4-Dimethoxybenzimidamide hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2,4-dimethoxybenzenecarboximidamide;hydrochloride (CAS 131947-81-4) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: 2,4-dimethoxybenzenecarboximidamide;hydrochloride. InChIKey: XHFJFBDPLBHYHR-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 2,4-dimethoxybenzenecarboximidamide;hydrochloride |
| InChIKey | XHFJFBDPLBHYHR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=N)N)OC.Cl |
Computed by PubChem (NCBI)