CAS 13217-34-0 appears in our catalog under these names: cis-3-Phenyltetrahydrofuran-2-carboxylic acid, 97%, rac-(2R,3R)-3-Phenyloxolane-2-carboxylic acid, rac-(2R,3R)-3-phenyloxolane-2-carboxylic acid, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg.
(2R,3R)-3-phenyloxolane-2-carboxylic acid (CAS 13217-34-0) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: (2R,3R)-3-phenyloxolane-2-carboxylic acid. InChIKey: SXFRYWQSHMYMKU-NXEZZACHSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | (2R,3R)-3-phenyloxolane-2-carboxylic acid |
| InChIKey | SXFRYWQSHMYMKU-NXEZZACHSA-N |
| SMILES | C1CO[C@H]([C@H]1C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)