Products 1932359-39-1

CAS 1932359-39-1 is the registry number for (2R,3R)-3-phenyltetrahydrofuran-2-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2R,3R)-3-phenyloxolane-2-carboxylic acid (CAS 1932359-39-1) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: (2R,3R)-3-phenyloxolane-2-carboxylic acid. InChIKey: SXFRYWQSHMYMKU-NXEZZACHSA-N.

Identity
Molecular formulaC11H12O3
Molecular weight192.21 g/mol
IUPAC name(2R,3R)-3-phenyloxolane-2-carboxylic acid
InChIKeySXFRYWQSHMYMKU-NXEZZACHSA-N
SMILESC1CO[C@H]([C@H]1C2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)