Products 1808784-86-2
CAS 1808784-86-2 is the registry number for (2S,3S)-3-Phenyltetrahydrofuran-2-carboxylic acid, 98%. Offered by: Chemat Brand, Ambeed. Available pack sizes: on request, 100mg, 250mg, 1g.
(2S,3S)-3-phenyloxolane-2-carboxylic acid (CAS 1808784-86-2) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: (2S,3S)-3-phenyloxolane-2-carboxylic acid. InChIKey: SXFRYWQSHMYMKU-UWVGGRQHSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | (2S,3S)-3-phenyloxolane-2-carboxylic acid |
| InChIKey | SXFRYWQSHMYMKU-UWVGGRQHSA-N |
| SMILES | C1CO[C@@H]([C@@H]1C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(2S,3S)-3-Phenyltetrahydrofuran-2-carboxylic acid, (2S,3S)-3-phenyloxolane-2-carboxylic acid, cis-3-Phenyltetrahydrofuran-2-carboxylic acid, rac-(2R,3R)-3-phenyloxolane-2-carboxylic acid, cis, threo-Pentonic acid, 2,5-anhydro-3,4-dideoxy-3-phenyl-, (2R,3R)-3-phenyltetrahydrofuran-2-carboxylic acid - [P84263]