CAS 132210-24-3 appears in our catalog under these names: 2–AMINO–3–(1,2–DIHYDRO–2–OXOQUINOLINE–4–YL)PROPANOIC ACID HYDROCHLORIDE, 2-amino-3-(2-oxo-1H-quinolin-4-yl)propanoic acid,hydrochloride, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 100g, 25g, 500g, 5g.
2-amino-3-(2-oxo-1H-quinolin-4-yl)propanoic acid;hydrochloride (CAS 132210-24-3) is a chemical compound with the molecular formula C12H13ClN2O3 and a molecular weight of 268.69 g/mol. IUPAC name: 2-amino-3-(2-oxo-1H-quinolin-4-yl)propanoic acid;hydrochloride. InChIKey: MPTXVJCCTVAVNL-UHFFFAOYSA-N.
| Molecular formula | C12H13ClN2O3 |
|---|---|
| Molecular weight | 268.69 g/mol |
| IUPAC name | 2-amino-3-(2-oxo-1H-quinolin-4-yl)propanoic acid;hydrochloride |
| InChIKey | MPTXVJCCTVAVNL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)N2)CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)