CAS 13262-46-9 appears in our catalog under these names: (2-Phenylphenyl)urea, 95%, (2-Phenylphenyl)urea. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
(2-phenylphenyl)urea (CAS 13262-46-9) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: (2-phenylphenyl)urea. InChIKey: HWLYIRABQGWLBV-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | (2-phenylphenyl)urea |
| InChIKey | HWLYIRABQGWLBV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2NC(=O)N |
Computed by PubChem (NCBI)