Products 132992-26-8
CAS 132992-26-8 is the registry number for 3,5-Difluoro-4-(trifluoromethyl)phenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2-[3,5-difluoro-4-(trifluoromethyl)phenyl]acetic acid (CAS 132992-26-8) is a chemical compound with the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. IUPAC name: 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]acetic acid. InChIKey: HLKJLXFZELUXCY-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O2 |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | HLKJLXFZELUXCY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(F)(F)F)F)CC(=O)O |
Computed by PubChem (NCBI)