Products 1823296-98-5
CAS 1823296-98-5 appears in our catalog under these names: Methyl 2,4-difluoro-5-(trifluoromethyl)benzoate, 95%, Methyl 2,4-Difluoro-5-(trifluoromethyl)benzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
Methyl 2,4-difluoro-5-(trifluoromethyl)benzoate (CAS 1823296-98-5) is a chemical compound with the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. IUPAC name: methyl 2,4-difluoro-5-(trifluoromethyl)benzoate. InChIKey: NPYCZGDHAGNYQQ-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O2 |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | methyl 2,4-difluoro-5-(trifluoromethyl)benzoate |
| InChIKey | NPYCZGDHAGNYQQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1F)F)C(F)(F)F |
Computed by PubChem (NCBI)