CAS 73790-11-1 appears in our catalog under these names: 2,2-Difluoro-2-[4-(trifluoromethyl)phenyl]acetic acid, 95%, 2,2-Difluoro-2-(4-(trifluoromethyl)phenyl)acetic Acid, 98%, 2,2–difluoro–2–(4–(trifluoromethyl)phenyl)acetic acid, 2,2-Difluoro-2-[4-(trifluoromethyl)phenyl]acetic Acid, 95%, 95%, 2,2-Difluoro-2-[4-(trifluoromethyl)phenyl]acetic acid, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 25g, 100mg.
2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetic acid (CAS 73790-11-1) is a chemical compound with the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. IUPAC name: 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetic acid. InChIKey: PWADLMFDFRCDMZ-UHFFFAOYSA-N.
| Molecular formula | C9H5F5O2 |
|---|---|
| Molecular weight | 240.13 g/mol |
| IUPAC name | 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | PWADLMFDFRCDMZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)